CAS 2700263-58-5 appears in our catalog under these names: TGFβ1-IN-2/ 99.2% (existing batch purity), N'-((5-Nitrothiophen-2-yl)methylene)-4-((6-(piperidin-1-yl)hexyl)oxy)benzohydrazide, 95%, 95%. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide (CAS 2700263-58-5) is a chemical compound with the molecular formula C23H30N4O4S and a molecular weight of 458.6 g/mol. IUPAC name: N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide. InChIKey: BEZBRPCBTXVWAM-HKOYGPOVSA-N.
| Molecular formula | C23H30N4O4S |
|---|---|
| Molecular weight | 458.6 g/mol |
| IUPAC name | N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide |
| InChIKey | BEZBRPCBTXVWAM-HKOYGPOVSA-N |
| SMILES | C1CCN(CC1)CCCCCCOC2=CC=C(C=C2)C(=O)N/N=C/C3=CC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)