CAS 2703582-76-5 appears in our catalog under these names: PF–06305591 dihydrate, PF-06305591 (dihydrate), 99.92%, 99.92%, PF-06305591 (dihydrate), 99.84%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10 mg, 5 mg, 10mM/1mL.
(2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide;dihydrate (CAS 2703582-76-5) is a chemical compound with the molecular formula C15H26N4O3 and a molecular weight of 310.39 g/mol. IUPAC name: (2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide;dihydrate. InChIKey: GDSIVFNMVSHSPL-KHEMJLMASA-N.
| Molecular formula | C15H26N4O3 |
|---|---|
| Molecular weight | 310.39 g/mol |
| IUPAC name | (2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide;dihydrate |
| InChIKey | GDSIVFNMVSHSPL-KHEMJLMASA-N |
| SMILES | C[C@H]([C@@H](C1=NC2=C(N1)C=C(C=C2)C(C)(C)C)N)C(=O)N.O.O |
Computed by PubChem (NCBI)