CAS 2703746-17-0 is the registry number for (3S,4S)-Benzyl 3-amino-4-methylpyrrolidine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Benzyl (3S,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride (CAS 2703746-17-0) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3S,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: XIVVOEPXDFGLFB-XOZOLZJESA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3S,4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | XIVVOEPXDFGLFB-XOZOLZJESA-N |
| SMILES | C[C@H]1CN(C[C@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)