Products 2707470-64-0
CAS 2707470-64-0 is the registry number for 9-(4'-chloro-[1,1'-biphenyl]-3-yl)phenanthrene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9-[3-(4-chlorophenyl)phenyl]phenanthrene (CAS 2707470-64-0) is a chemical compound with the molecular formula C26H17Cl and a molecular weight of 364.9 g/mol. IUPAC name: 9-[3-(4-chlorophenyl)phenyl]phenanthrene. InChIKey: IHVHNKACDAMZOB-UHFFFAOYSA-N.
| Molecular formula | C26H17Cl |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 9-[3-(4-chlorophenyl)phenyl]phenanthrene |
| InChIKey | IHVHNKACDAMZOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)C4=CC=CC(=C4)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)