Products 2708283-05-8
CAS 2708283-05-8 appears in our catalog under these names: (±)-3-Quinuclidinol-2,2,3,6,6,7,7-d7, 99 atom % D, min 98% Chemical Purity, 3-Quinuclidinol-d7. Offered by: CDN, TRC. Available pack sizes: 0,1g, 0,05g, 100mg, 25mg, 5mg.
2,2,3,6,6,7,7-heptadeuterio-1-azabicyclo[2.2.2]octan-3-ol (CAS 2708283-05-8) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 134.23 g/mol. IUPAC name: 2,2,3,6,6,7,7-heptadeuterio-1-azabicyclo[2.2.2]octan-3-ol. InChIKey: IVLICPVPXWEGCA-VNNFUXIKSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 134.23 g/mol |
| IUPAC name | 2,2,3,6,6,7,7-heptadeuterio-1-azabicyclo[2.2.2]octan-3-ol |
| InChIKey | IVLICPVPXWEGCA-VNNFUXIKSA-N |
| SMILES | [2H]C1(CC2CC(N1C(C2([2H])O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)