Products 2724942-14-5
CAS 2724942-14-5 appears in our catalog under these names: AS3334034 >= 98 % HPLC 5 Mg, AS3334034 >= 98 % HPLC 25 Mg. Offered by: Sigma-Aldrich. Available pack sizes: 5MG, 25MG.
6-tert-butylsulfonyl-7-methoxy-N-(4-methyl-1H-pyrazol-5-yl)quinolin-4-amine (CAS 2724942-14-5) is a chemical compound with the molecular formula C18H22N4O3S and a molecular weight of 374.5 g/mol. IUPAC name: 6-tert-butylsulfonyl-7-methoxy-N-(4-methyl-1H-pyrazol-5-yl)quinolin-4-amine. InChIKey: WCPMUQAUSFXFJE-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O3S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 6-tert-butylsulfonyl-7-methoxy-N-(4-methyl-1H-pyrazol-5-yl)quinolin-4-amine |
| InChIKey | WCPMUQAUSFXFJE-UHFFFAOYSA-N |
| SMILES | CC1=C(NN=C1)NC2=C3C=C(C(=CC3=NC=C2)OC)S(=O)(=O)C(C)(C)C |
Computed by PubChem (NCBI)