Products 2725774-15-0

CAS 2725774-15-0 is the registry number for tert-Butyl ((2S,3R)-2-methylazetidin-3-yl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride (CAS 2725774-15-0) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(2S,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-UOERWJHTSA-N.

Identity
Molecular formulaC9H19ClN2O2
Molecular weight222.71 g/mol
IUPAC nametert-butyl N-[(2S,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride
InChIKeyQEGLJGQQFDDFJO-UOERWJHTSA-N
SMILESC[C@H]1[C@@H](CN1)NC(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)