CAS 2733539-08-5 is the registry number for 3-Hydroxypyridine-d5, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2,3,4,6-tetradeuterio-5-deuteriooxypyridine (CAS 2733539-08-5) is a chemical compound with the molecular formula C5H5NO and a molecular weight of 100.13 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-deuteriooxypyridine. InChIKey: GRFNBEZIAWKNCO-HXRFYODMSA-N.
| Molecular formula | C5H5NO |
|---|---|
| Molecular weight | 100.13 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-deuteriooxypyridine |
| InChIKey | GRFNBEZIAWKNCO-HXRFYODMSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)