CAS 2734776-24-8 is the registry number for 1,3-Dibromo-5-isopropyl-2-(methoxymethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-dibromo-2-(methoxymethyl)-5-propan-2-ylbenzene (CAS 2734776-24-8) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 1,3-dibromo-2-(methoxymethyl)-5-propan-2-ylbenzene. InChIKey: KRLNTSKTXMYKQG-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 1,3-dibromo-2-(methoxymethyl)-5-propan-2-ylbenzene |
| InChIKey | KRLNTSKTXMYKQG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)COC)Br |
Computed by PubChem (NCBI)