CAS 2740593-36-4 is the registry number for (R)-2-(Difluoromethyl)piperazine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
(2R)-2-(difluoromethyl)piperazine;dihydrochloride (CAS 2740593-36-4) is a chemical compound with the molecular formula C5H12Cl2F2N2 and a molecular weight of 209.06 g/mol. IUPAC name: (2R)-2-(difluoromethyl)piperazine;dihydrochloride. InChIKey: BCDKVYMYUQMADS-RZFWHQLPSA-N.
| Molecular formula | C5H12Cl2F2N2 |
|---|---|
| Molecular weight | 209.06 g/mol |
| IUPAC name | (2R)-2-(difluoromethyl)piperazine;dihydrochloride |
| InChIKey | BCDKVYMYUQMADS-RZFWHQLPSA-N |
| SMILES | C1CN[C@H](CN1)C(F)F.Cl.Cl |
Computed by PubChem (NCBI)