CAS 2742090-82-8 is the registry number for 3-[[(3S)-1,1-dioxothiolan-3-yl]amino]propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-[[(3S)-1,1-dioxothiolan-3-yl]amino]propanoic acid (CAS 2742090-82-8) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 3-[[(3S)-1,1-dioxothiolan-3-yl]amino]propanoic acid. InChIKey: IKVXZBQFTASZSZ-LURJTMIESA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 3-[[(3S)-1,1-dioxothiolan-3-yl]amino]propanoic acid |
| InChIKey | IKVXZBQFTASZSZ-LURJTMIESA-N |
| SMILES | C1CS(=O)(=O)C[C@H]1NCCC(=O)O |
Computed by PubChem (NCBI)