Products 2748161-90-0
CAS 2748161-90-0 is the registry number for ADB–FUBICA. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indole-3-carboxamide (CAS 2748161-90-0) is a chemical compound with the molecular formula C22H24FN3O2 and a molecular weight of 381.4 g/mol. IUPAC name: N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indole-3-carboxamide. InChIKey: QIFOZYUACLDTAJ-UHFFFAOYSA-N.
| Molecular formula | C22H24FN3O2 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indole-3-carboxamide |
| InChIKey | QIFOZYUACLDTAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)N)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)