Products 2750602-57-2
CAS 2750602-57-2 is the registry number for Methyl 4-(1-isopropyl-4-(trifluoromethyl)-1H-imidazol-2-yl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]benzoate (CAS 2750602-57-2) is a chemical compound with the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. IUPAC name: methyl 4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]benzoate. InChIKey: MVLTYJWQFKSOND-UHFFFAOYSA-N.
| Molecular formula | C15H15F3N2O2 |
|---|---|
| Molecular weight | 312.29 g/mol |
| IUPAC name | methyl 4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]benzoate |
| InChIKey | MVLTYJWQFKSOND-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(N=C1C2=CC=C(C=C2)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)