Products 2760174-78-3
CAS 2760174-78-3 is the registry number for 2-(8-Chloro-1-naphthalenyl)-4,6-dipheny-1,3,5-Triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(8-chloronaphthalen-1-yl)-4,6-diphenyl-1,3,5-triazine (CAS 2760174-78-3) is a chemical compound with the molecular formula C25H16ClN3 and a molecular weight of 393.9 g/mol. IUPAC name: 2-(8-chloronaphthalen-1-yl)-4,6-diphenyl-1,3,5-triazine. InChIKey: GGLQRVRGCMZNAR-UHFFFAOYSA-N.
| Molecular formula | C25H16ClN3 |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 2-(8-chloronaphthalen-1-yl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | GGLQRVRGCMZNAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC4=C3C(=CC=C4)Cl)C5=CC=CC=C5 |
Computed by PubChem (NCBI)