Products 2761147-94-6
CAS 2761147-94-6 is the registry number for OXS007417. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(difluoromethoxy)phenyl]-6-(4-fluoro-2-methylphenyl)imidazo[4,5-c]pyridine (CAS 2761147-94-6) is a chemical compound with the molecular formula C20H14F3N3O and a molecular weight of 369.3 g/mol. IUPAC name: 1-[4-(difluoromethoxy)phenyl]-6-(4-fluoro-2-methylphenyl)imidazo[4,5-c]pyridine. InChIKey: UZMNRNLKNVPBTB-UHFFFAOYSA-N.
| Molecular formula | C20H14F3N3O |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | 1-[4-(difluoromethoxy)phenyl]-6-(4-fluoro-2-methylphenyl)imidazo[4,5-c]pyridine |
| InChIKey | UZMNRNLKNVPBTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C2=NC=C3C(=C2)N(C=N3)C4=CC=C(C=C4)OC(F)F |
Computed by PubChem (NCBI)