CAS 2762180-28-7 appears in our catalog under these names: GPR84 antagonist 1, GPR84 antagonist 1, 99%, 99%, GPR84 antagonist 1, 98.56%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10mM/1mL, 10 mg, 5 mg.
3-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-1H-indole (CAS 2762180-28-7) is a chemical compound with the molecular formula C26H22N4O2 and a molecular weight of 422.5 g/mol. IUPAC name: 3-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-1H-indole. InChIKey: LMEQXULLLIXQFQ-UHFFFAOYSA-N.
| Molecular formula | C26H22N4O2 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 3-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]methyl]-1H-indole |
| InChIKey | LMEQXULLLIXQFQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(N=NC(=N2)CC3=CNC4=CC=CC=C43)C5=CC=C(C=C5)OC |
Computed by PubChem (NCBI)