CAS 2762697-58-3 is the registry number for Potassium (3-((benzyloxy)carbonyl)-3-azabicyclo[4.1.0]heptan-6-yl)trifluoroborate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-(3-phenylmethoxycarbonyl-3-azabicyclo[4.1.0]heptan-6-yl)boranuide (CAS 2762697-58-3) is a chemical compound with the molecular formula C14H16BF3KNO2 and a molecular weight of 337.19 g/mol. IUPAC name: potassium trifluoro-(3-phenylmethoxycarbonyl-3-azabicyclo[4.1.0]heptan-6-yl)boranuide. InChIKey: HBLCWPZBNCDRSZ-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3KNO2 |
|---|---|
| Molecular weight | 337.19 g/mol |
| IUPAC name | potassium trifluoro-(3-phenylmethoxycarbonyl-3-azabicyclo[4.1.0]heptan-6-yl)boranuide |
| InChIKey | HBLCWPZBNCDRSZ-UHFFFAOYSA-N |
| SMILES | [B-](C12CCN(CC1C2)C(=O)OCC3=CC=CC=C3)(F)(F)F.[K+] |
Computed by PubChem (NCBI)