CAS 2764728-34-7 is the registry number for 3,5-Dichloro-4-ethoxy-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-dichloro-2-ethoxy-5-phenylbenzene (CAS 2764728-34-7) is a chemical compound with the molecular formula C14H12Cl2O and a molecular weight of 267.1 g/mol. IUPAC name: 1,3-dichloro-2-ethoxy-5-phenylbenzene. InChIKey: VSYDTUBBPSVFQN-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O |
|---|---|
| Molecular weight | 267.1 g/mol |
| IUPAC name | 1,3-dichloro-2-ethoxy-5-phenylbenzene |
| InChIKey | VSYDTUBBPSVFQN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)