Products 2765294-54-8
CAS 2765294-54-8 is the registry number for TRPV1 antagonist 3, 98.97%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10mM/1mL, 25 mg, 5 mg, 10 mg, 50 mg.
(2S)-2-(5-phenyl-1,3-thiazol-2-yl)-N-(3-propan-2-ylphenyl)pyrrolidine-1-carboxamide (CAS 2765294-54-8) is a chemical compound with the molecular formula C23H25N3OS and a molecular weight of 391.5 g/mol. IUPAC name: (2S)-2-(5-phenyl-1,3-thiazol-2-yl)-N-(3-propan-2-ylphenyl)pyrrolidine-1-carboxamide. InChIKey: CZISSZWUQQBGMU-FQEVSTJZSA-N.
| Molecular formula | C23H25N3OS |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S)-2-(5-phenyl-1,3-thiazol-2-yl)-N-(3-propan-2-ylphenyl)pyrrolidine-1-carboxamide |
| InChIKey | CZISSZWUQQBGMU-FQEVSTJZSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)NC(=O)N2CCC[C@H]2C3=NC=C(S3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)