Products 2766146-79-4
CAS 2766146-79-4 is the registry number for NOS-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[3-(2-amino-5-methoxyphenyl)-3-hydroxypropyl]-4-(trifluoromethyl)benzenecarboximidamide (CAS 2766146-79-4) is a chemical compound with the molecular formula C18H20F3N3O2 and a molecular weight of 367.4 g/mol. IUPAC name: N'-[3-(2-amino-5-methoxyphenyl)-3-hydroxypropyl]-4-(trifluoromethyl)benzenecarboximidamide. InChIKey: XZUCYJQFUVCEDN-UHFFFAOYSA-N.
| Molecular formula | C18H20F3N3O2 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | N'-[3-(2-amino-5-methoxyphenyl)-3-hydroxypropyl]-4-(trifluoromethyl)benzenecarboximidamide |
| InChIKey | XZUCYJQFUVCEDN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)C(CCN=C(C2=CC=C(C=C2)C(F)(F)F)N)O |
Computed by PubChem (NCBI)