Products 276704-21-3
CAS 276704-21-3 is the registry number for MRL-1237. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]pyridin-4-imine;hydrochloride (CAS 276704-21-3) is a chemical compound with the molecular formula C19H16ClFN4 and a molecular weight of 354.8 g/mol. IUPAC name: 1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]pyridin-4-imine;hydrochloride. InChIKey: OQLKNESERKFJAI-UHFFFAOYSA-N.
| Molecular formula | C19H16ClFN4 |
|---|---|
| Molecular weight | 354.8 g/mol |
| IUPAC name | 1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]pyridin-4-imine;hydrochloride |
| InChIKey | OQLKNESERKFJAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C3=CC=C(C=C3)F)CN4C=CC(=N)C=C4.Cl |
Computed by PubChem (NCBI)