Products 2767359-27-1
CAS 2767359-27-1 is the registry number for 9-(4′-Chloro[1,1′-biphenyl]-2-yl)-3-phenyl-9H-carbazole, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9-[2-(4-chlorophenyl)phenyl]-3-phenylcarbazole (CAS 2767359-27-1) is a chemical compound with the molecular formula C30H20ClN and a molecular weight of 429.9 g/mol. IUPAC name: 9-[2-(4-chlorophenyl)phenyl]-3-phenylcarbazole. InChIKey: OJWVLBCIQLLQBX-UHFFFAOYSA-N.
| Molecular formula | C30H20ClN |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | 9-[2-(4-chlorophenyl)phenyl]-3-phenylcarbazole |
| InChIKey | OJWVLBCIQLLQBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C5=CC=CC=C5C6=CC=C(C=C6)Cl |
Computed by PubChem (NCBI)