Products 2767529-32-6
CAS 2767529-32-6 is the registry number for 2-(3-(tert-Butyl)-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-tert-butyl-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2767529-32-6) is a chemical compound with the molecular formula C16H24BFO2 and a molecular weight of 278.2 g/mol. IUPAC name: 2-(3-tert-butyl-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RQNBEOAQCOZRDP-UHFFFAOYSA-N.
| Molecular formula | C16H24BFO2 |
|---|---|
| Molecular weight | 278.2 g/mol |
| IUPAC name | 2-(3-tert-butyl-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RQNBEOAQCOZRDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)C(C)(C)C |
Computed by PubChem (NCBI)