Products 2770271-24-2
CAS 2770271-24-2 is the registry number for tert-Butyl 3-iodo-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrimidine-4(5H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-iodo-5-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carboxylate (CAS 2770271-24-2) is a chemical compound with the molecular formula C12H18IN3O2 and a molecular weight of 363.19 g/mol. IUPAC name: tert-butyl 3-iodo-5-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carboxylate. InChIKey: YFWGJGCSUDDIKH-UHFFFAOYSA-N.
| Molecular formula | C12H18IN3O2 |
|---|---|
| Molecular weight | 363.19 g/mol |
| IUPAC name | tert-butyl 3-iodo-5-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidine-4-carboxylate |
| InChIKey | YFWGJGCSUDDIKH-UHFFFAOYSA-N |
| SMILES | CC1CCN2C(=C(C=N2)I)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)