CAS 2770532-78-8 is the registry number for 4,4,5,5-Tetramethyl-2-(6'-phenyl-[1,1':2',1''-terphenyl]-4'-yl)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(3,4,5-triphenylphenyl)-1,3,2-dioxaborolane (CAS 2770532-78-8) is a chemical compound with the molecular formula C30H29BO2 and a molecular weight of 432.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-triphenylphenyl)-1,3,2-dioxaborolane. InChIKey: QYIRRQBZOPGGLL-UHFFFAOYSA-N.
| Molecular formula | C30H29BO2 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-triphenylphenyl)-1,3,2-dioxaborolane |
| InChIKey | QYIRRQBZOPGGLL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)