Products 2778223-52-0
CAS 2778223-52-0 appears in our catalog under these names: Pralsetinib Impurity 2, Cis cyclohexane carboxylic acid, 1-methoxy-4-[4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl]-, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g, 5g.
1-methoxy-4-[4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]cyclohexane-1-carboxylic acid (CAS 2778223-52-0) is a chemical compound with the molecular formula C17H23N5O3 and a molecular weight of 345.4 g/mol. IUPAC name: 1-methoxy-4-[4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]cyclohexane-1-carboxylic acid. InChIKey: QKVACMCXFIAPPC-UHFFFAOYSA-N.
| Molecular formula | C17H23N5O3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 1-methoxy-4-[4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]cyclohexane-1-carboxylic acid |
| InChIKey | QKVACMCXFIAPPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2)C)C3CCC(CC3)(C(=O)O)OC |
Computed by PubChem (NCBI)