CAS 2787493-24-5 is the registry number for (2-Bromo-6-fluorophenyl)bis(2,3,6-trifluorophenyl)borane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-6-fluorophenyl)-bis(2,3,6-trifluorophenyl)borane (CAS 2787493-24-5) is a chemical compound with the molecular formula C18H7BBrF7 and a molecular weight of 447.0 g/mol. IUPAC name: (2-bromo-6-fluorophenyl)-bis(2,3,6-trifluorophenyl)borane. InChIKey: FPLZOKQCIVRXSH-UHFFFAOYSA-N.
| Molecular formula | C18H7BBrF7 |
|---|---|
| Molecular weight | 447.0 g/mol |
| IUPAC name | (2-bromo-6-fluorophenyl)-bis(2,3,6-trifluorophenyl)borane |
| InChIKey | FPLZOKQCIVRXSH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Br)F)(C2=C(C=CC(=C2F)F)F)C3=C(C=CC(=C3F)F)F |
Computed by PubChem (NCBI)