CAS 2787497-54-3 is the registry number for Rel-tert-butyl (6S,7S)-6-methyl-7-((methylsulfonyl)oxy)-2-azaspiro[3.5]nonane-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (6S,7S)-6-methyl-7-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate (CAS 2787497-54-3) is a chemical compound with the molecular formula C15H27NO5S and a molecular weight of 333.4 g/mol. IUPAC name: tert-butyl (6S,7S)-6-methyl-7-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate. InChIKey: LKVWYSFPWAJANR-RYUDHWBXSA-N.
| Molecular formula | C15H27NO5S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | tert-butyl (6S,7S)-6-methyl-7-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate |
| InChIKey | LKVWYSFPWAJANR-RYUDHWBXSA-N |
| SMILES | C[C@H]1CC2(CC[C@@H]1OS(=O)(=O)C)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)