Products 2791448-89-8
CAS 2791448-89-8 is the registry number for rel-tert-Butyl (2R,4R)-4-((tert-butyldimethylsilyl)oxy)-2-formylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate (CAS 2791448-89-8) is a chemical compound with the molecular formula C17H33NO4Si and a molecular weight of 343.5 g/mol. IUPAC name: tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate. InChIKey: GPOYMEYCJJKXFS-ZIAGYGMSSA-N.
| Molecular formula | C17H33NO4Si |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate |
| InChIKey | GPOYMEYCJJKXFS-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C[C@@H]1C=O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)