CAS 2797182-54-6 is the registry number for Rel-(3aR,6aR)-3a-(hydroxymethyl)tetrahydro-1H,3H-thieno[3,4-c]furan-1-one 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aR)-6a-(hydroxymethyl)-5,5-dioxo-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one (CAS 2797182-54-6) is a chemical compound with the molecular formula C7H10O5S and a molecular weight of 206.22 g/mol. IUPAC name: (3aR,6aR)-6a-(hydroxymethyl)-5,5-dioxo-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one. InChIKey: UKIQIGXKILDASJ-FSPLSTOPSA-N.
| Molecular formula | C7H10O5S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | (3aR,6aR)-6a-(hydroxymethyl)-5,5-dioxo-1,3a,4,6-tetrahydrothieno[3,4-c]furan-3-one |
| InChIKey | UKIQIGXKILDASJ-FSPLSTOPSA-N |
| SMILES | C1[C@H]2C(=O)OC[C@]2(CS1(=O)=O)CO |
Computed by PubChem (NCBI)