Products 2803279-88-9
CAS 2803279-88-9 is the registry number for Methyl 2-amino-4-bromo-3-fluoro-5-iodobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2-amino-4-bromo-3-fluoro-5-iodobenzoate (CAS 2803279-88-9) is a chemical compound with the molecular formula C8H6BrFINO2 and a molecular weight of 373.95 g/mol. IUPAC name: methyl 2-amino-4-bromo-3-fluoro-5-iodobenzoate. InChIKey: SEAFOGDXKFBVQI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFINO2 |
|---|---|
| Molecular weight | 373.95 g/mol |
| IUPAC name | methyl 2-amino-4-bromo-3-fluoro-5-iodobenzoate |
| InChIKey | SEAFOGDXKFBVQI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1N)F)Br)I |
Computed by PubChem (NCBI)