Products 2803419-90-9
CAS 2803419-90-9 appears in our catalog under these names: methyl 4-(2-chloroacetyl)-1H-pyrrole-2-carboxylate, 95%, 95%, Edoxaban impurity 65, 99.75%. Offered by: Chemat, MedChemExpress. Available pack sizes: 50mg, 10 mg, 25 mg, 50 mg, 5 mg.
2-[[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-2-oxoacetic acid (CAS 2803419-90-9) is a chemical compound with the molecular formula C16H27N3O6 and a molecular weight of 357.40 g/mol. IUPAC name: 2-[[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-2-oxoacetic acid. InChIKey: MNIFXJSCAKUZOX-GARJFASQSA-N.
| Molecular formula | C16H27N3O6 |
|---|---|
| Molecular weight | 357.40 g/mol |
| IUPAC name | 2-[[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]-2-oxoacetic acid |
| InChIKey | MNIFXJSCAKUZOX-GARJFASQSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1NC(=O)C(=O)O)C(=O)N(C)C |
Computed by PubChem (NCBI)