CAS 2803420-48-4 is the registry number for Syringetin 3-O-beta-D-glucoside, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg.
N-methyl-N-[(3S,4S)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride (CAS 2803420-48-4) is a chemical compound with the molecular formula C13H21Cl2N5 and a molecular weight of 318.2 g/mol. IUPAC name: N-methyl-N-[(3S,4S)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride. InChIKey: KSODOXNLLQKTEM-NAUXGDFUSA-N.
| Molecular formula | C13H21Cl2N5 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | N-methyl-N-[(3S,4S)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
| InChIKey | KSODOXNLLQKTEM-NAUXGDFUSA-N |
| SMILES | C[C@H]1CCNC[C@H]1N(C)C2=NC=NC3=C2C=CN3.Cl.Cl |
Computed by PubChem (NCBI)