Products 2803477-01-0
CAS 2803477-01-0 is the registry number for 5-Nitrospiro[indoline-3,4'-piperidin]-2-one hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
5-nitrospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CAS 2803477-01-0) is a chemical compound with the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. IUPAC name: 5-nitrospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride. InChIKey: GHAFFEMNAVRRGT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O3 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 5-nitrospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | GHAFFEMNAVRRGT-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)[N+](=O)[O-])NC2=O.Cl |
Computed by PubChem (NCBI)