Products 2803951-18-8
CAS 2803951-18-8 is the registry number for URAT1 inhibitor 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-[(4-bromonaphthalen-1-yl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-2-methylpropanoic acid (CAS 2803951-18-8) is a chemical compound with the molecular formula C21H18BrN3O2S and a molecular weight of 456.4 g/mol. IUPAC name: 2-[1-[(4-bromonaphthalen-1-yl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-2-methylpropanoic acid. InChIKey: VKHXJKYGFGXZSS-UHFFFAOYSA-N.
| Molecular formula | C21H18BrN3O2S |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 2-[1-[(4-bromonaphthalen-1-yl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-2-methylpropanoic acid |
| InChIKey | VKHXJKYGFGXZSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)SC1=NC2=C(N1CC3=CC=C(C4=CC=CC=C34)Br)C=CC=N2 |
Computed by PubChem (NCBI)