CAS 2813227-80-2 is the registry number for (R)-4-((R)-1-Aminoethyl)-2,2-difluoro-3-hydroxy-2,3-dihydrobenzo[b]thiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-4-[(1R)-1-aminoethyl]-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-3-ol (CAS 2813227-80-2) is a chemical compound with the molecular formula C10H11F2NO3S and a molecular weight of 263.26 g/mol. IUPAC name: (3R)-4-[(1R)-1-aminoethyl]-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-3-ol. InChIKey: QEDPLOSNSKKZEK-MLUIRONXSA-N.
| Molecular formula | C10H11F2NO3S |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | (3R)-4-[(1R)-1-aminoethyl]-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-3-ol |
| InChIKey | QEDPLOSNSKKZEK-MLUIRONXSA-N |
| SMILES | C[C@H](C1=C2[C@H](C(S(=O)(=O)C2=CC=C1)(F)F)O)N |
Computed by PubChem (NCBI)