CAS 2816818-20-7 is the registry number for rel-(1r,3r)-N-Benzhydryl-3-(4-bromophenyl)cyclobutan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-benzhydryl-3-(4-bromophenyl)cyclobutan-1-amine (CAS 2816818-20-7) is a chemical compound with the molecular formula C23H22BrN and a molecular weight of 392.3 g/mol. IUPAC name: N-benzhydryl-3-(4-bromophenyl)cyclobutan-1-amine. InChIKey: KOHMRDXRQFYFMP-UHFFFAOYSA-N.
| Molecular formula | C23H22BrN |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | N-benzhydryl-3-(4-bromophenyl)cyclobutan-1-amine |
| InChIKey | KOHMRDXRQFYFMP-UHFFFAOYSA-N |
| SMILES | C1C(CC1NC(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)