CAS 2816821-11-9 is the registry number for tert-Butyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamate (CAS 2816821-11-9) is a chemical compound with the molecular formula C21H28BNO4 and a molecular weight of 369.3 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamate. InChIKey: DRGYCYMQKMNCBM-UHFFFAOYSA-N.
| Molecular formula | C21H28BNO4 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamate |
| InChIKey | DRGYCYMQKMNCBM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=CC=CC=C23)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)