Products 2819779-01-4
CAS 2819779-01-4 appears in our catalog under these names: PDE4B-IN-3, 99.37%, PDE4B-IN-3, 99%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 10 mg, 10mM/1mL, 100 mg, 25 mg, 50 mg, 1mg, 5mg.
N-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]quinoline-8-sulfonamide (CAS 2819779-01-4) is a chemical compound with the molecular formula C30H35N3O4S2 and a molecular weight of 565.8 g/mol. IUPAC name: N-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]quinoline-8-sulfonamide. InChIKey: KNCHLPMJSHBPHC-UHFFFAOYSA-N.
| Molecular formula | C30H35N3O4S2 |
|---|---|
| Molecular weight | 565.8 g/mol |
| IUPAC name | N-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]quinoline-8-sulfonamide |
| InChIKey | KNCHLPMJSHBPHC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)NC2=CC=CC(=C2)NS(=O)(=O)C3=CC=CC4=C3N=CC=C4)C(C)C |
Computed by PubChem (NCBI)