Products 2820126-32-5
CAS 2820126-32-5 is the registry number for EGFR/HER2-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-methylphenyl)-N'-propanoylimidazo[2,1-b][1,3]thiazole-3-carbohydrazide (CAS 2820126-32-5) is a chemical compound with the molecular formula C16H16N4O2S and a molecular weight of 328.4 g/mol. IUPAC name: 5-(4-methylphenyl)-N'-propanoylimidazo[2,1-b][1,3]thiazole-3-carbohydrazide. InChIKey: VNEUERRAUAGHGO-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O2S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 5-(4-methylphenyl)-N'-propanoylimidazo[2,1-b][1,3]thiazole-3-carbohydrazide |
| InChIKey | VNEUERRAUAGHGO-UHFFFAOYSA-N |
| SMILES | CCC(=O)NNC(=O)C1=CSC2=NC=C(N12)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)