Products 2820126-37-0
CAS 2820126-37-0 is the registry number for EGFR/HER2/DHFR-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-acetyl-5-(4-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide (CAS 2820126-37-0) is a chemical compound with the molecular formula C14H11BrN4O2S and a molecular weight of 379.23 g/mol. IUPAC name: N'-acetyl-5-(4-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide. InChIKey: OJCVSCAUEKBQAE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN4O2S |
|---|---|
| Molecular weight | 379.23 g/mol |
| IUPAC name | N'-acetyl-5-(4-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide |
| InChIKey | OJCVSCAUEKBQAE-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC(=O)C1=CSC2=NC=C(N12)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)