Products 2820424-81-3
CAS 2820424-81-3 is the registry number for α-Glucosidase-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]benzoic acid (CAS 2820424-81-3) is a chemical compound with the molecular formula C23H19NO2S and a molecular weight of 373.5 g/mol. IUPAC name: 4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]benzoic acid. InChIKey: NYXYLPZYOPGUAD-UHFFFAOYSA-N.
| Molecular formula | C23H19NO2S |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]benzoic acid |
| InChIKey | NYXYLPZYOPGUAD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3SC(C2)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)