Products 2820424-85-7
CAS 2820424-85-7 is the registry number for α-Glucosidase-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dimethyl-4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]aniline (CAS 2820424-85-7) is a chemical compound with the molecular formula C24H24N2S and a molecular weight of 372.5 g/mol. IUPAC name: N,N-dimethyl-4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]aniline. InChIKey: OTFYCFPFAJIPLA-UHFFFAOYSA-N.
| Molecular formula | C24H24N2S |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | N,N-dimethyl-4-[4-(4-methylphenyl)-2,3-dihydro-1,5-benzothiazepin-2-yl]aniline |
| InChIKey | OTFYCFPFAJIPLA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3SC(C2)C4=CC=C(C=C4)N(C)C |
Computed by PubChem (NCBI)