Products 2820536-86-3
CAS 2820536-86-3 is the registry number for Methyl 2-amino-3,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-amino-3,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2820536-86-3) is a chemical compound with the molecular formula C14H18BF2NO4 and a molecular weight of 313.11 g/mol. IUPAC name: methyl 2-amino-3,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: HBQDQDUAXSJYSI-UHFFFAOYSA-N.
| Molecular formula | C14H18BF2NO4 |
|---|---|
| Molecular weight | 313.11 g/mol |
| IUPAC name | methyl 2-amino-3,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | HBQDQDUAXSJYSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)N)C(=O)OC)F |
Computed by PubChem (NCBI)