Products 2820537-74-2
CAS 2820537-74-2 is the registry number for (S,E)-(2-(Fluoromethylene)tetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(6E,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol (CAS 2820537-74-2) is a chemical compound with the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. IUPAC name: [(6E,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol. InChIKey: GZEVXTHNYVCIIO-QRJSTWQJSA-N.
| Molecular formula | C9H14FNO |
|---|---|
| Molecular weight | 171.21 g/mol |
| IUPAC name | [(6E,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
| InChIKey | GZEVXTHNYVCIIO-QRJSTWQJSA-N |
| SMILES | C1C[C@]2(C/C(=C\F)/CN2C1)CO |
Computed by PubChem (NCBI)