Products 2821859-71-4
CAS 2821859-71-4 appears in our catalog under these names: GPR88 agonist 2, GPR88 agonist 2, 99.57%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 10 mg, 10mM/1mL, 100 mg, 25 mg.
N-methyl-1-[(2R)-2-[4-[(2S)-2-methylbutoxy]phenyl]-2-[[(2S)-2-phenylpropanoyl]amino]ethyl]triazole-4-carboxamide (CAS 2821859-71-4) is a chemical compound with the molecular formula C26H33N5O3 and a molecular weight of 463.6 g/mol. IUPAC name: N-methyl-1-[(2R)-2-[4-[(2S)-2-methylbutoxy]phenyl]-2-[[(2S)-2-phenylpropanoyl]amino]ethyl]triazole-4-carboxamide. InChIKey: LVUMROGMIIBKQA-YDHSSHFGSA-N.
| Molecular formula | C26H33N5O3 |
|---|---|
| Molecular weight | 463.6 g/mol |
| IUPAC name | N-methyl-1-[(2R)-2-[4-[(2S)-2-methylbutoxy]phenyl]-2-[[(2S)-2-phenylpropanoyl]amino]ethyl]triazole-4-carboxamide |
| InChIKey | LVUMROGMIIBKQA-YDHSSHFGSA-N |
| SMILES | CC[C@H](C)COC1=CC=C(C=C1)[C@H](CN2C=C(N=N2)C(=O)NC)NC(=O)[C@@H](C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)