CAS 282732-36-9 is the registry number for N-2-Aminoethyl-Val-Leu-anilide. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide (CAS 282732-36-9) is a chemical compound with the molecular formula C19H32N4O2 and a molecular weight of 348.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide. InChIKey: UABCFHFXPFDWCS-IRXDYDNUSA-N.
| Molecular formula | C19H32N4O2 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(2-aminoethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide |
| InChIKey | UABCFHFXPFDWCS-IRXDYDNUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC1=CC=CC=C1)NC(=O)[C@H](C(C)C)NCCN |
Computed by PubChem (NCBI)