CAS 2840801-49-0 is the registry number for O9-tert-butyl O7-methyl endo-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
9-O-tert-butyl 7-O-methyl (1S,5R)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate (CAS 2840801-49-0) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 9-O-tert-butyl 7-O-methyl (1S,5R)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate. InChIKey: UUIAWYLQFAYJMO-FGWVZKOKSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 9-O-tert-butyl 7-O-methyl (1S,5R)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate |
| InChIKey | UUIAWYLQFAYJMO-FGWVZKOKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC(C[C@H]1COC2)C(=O)OC |
Computed by PubChem (NCBI)