Products 2848581-84-8
CAS 2848581-84-8 is the registry number for PTP1B-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[2-[(6-naphthalen-2-yloxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoic acid (CAS 2848581-84-8) is a chemical compound with the molecular formula C26H19N3O4S and a molecular weight of 469.5 g/mol. IUPAC name: 4-[[2-[(6-naphthalen-2-yloxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoic acid. InChIKey: BWMULTFSOOKLFT-UHFFFAOYSA-N.
| Molecular formula | C26H19N3O4S |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | 4-[[2-[(6-naphthalen-2-yloxy-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoic acid |
| InChIKey | BWMULTFSOOKLFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OC3=CC4=C(C=C3)N=C(N4)SCC(=O)NC5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)