Products 2848719-34-4
CAS 2848719-34-4 is the registry number for FAAH/MAGL-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-nitrophenyl) 4-(4-butylphenyl)sulfonylpiperazine-1-carboxylate (CAS 2848719-34-4) is a chemical compound with the molecular formula C21H25N3O6S and a molecular weight of 447.5 g/mol. IUPAC name: (4-nitrophenyl) 4-(4-butylphenyl)sulfonylpiperazine-1-carboxylate. InChIKey: WSNBDRIOXKWWCY-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O6S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | (4-nitrophenyl) 4-(4-butylphenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | WSNBDRIOXKWWCY-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)